C19H25NO6 — CID 11314481
N-benzyl-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanimine oxide (PubChem CID 11314481) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is N-benzyl-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanimine oxide.
| Compound Name | N-benzyl-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanimine oxide |
|---|---|
| PubChem CID | 11314481 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-benzyl-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanimine oxide |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](/C=[N+](/[O-])Cc1ccccc1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C19H25NO6/c1-18(2)23-14-13(11-20(21)10-12-8-6-5-7-9-12)22-17-16(15(14)24-18)25-19(3,4)26-17/h5-9,11,13-17H,10H2,1-4H3/b20-11+/t13-,14+,15+,16-,17-/m1/s1 |
| InChIKey | ZWWHPBXOFRCBMM-OWYAICOBSA-N |
| XLogP | 2.16 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|