C21H24N2O4 — CID 10959557
N-benzyl-1-[(4S,5S)-5-[(Z)-[benzyl(oxido)azaniumylidene]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide (PubChem CID 10959557) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-benzyl-1-[(4S,5S)-5-[(Z)-[benzyl(oxido)azaniumylidene]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide.
| Compound Name | N-benzyl-1-[(4S,5S)-5-[(Z)-[benzyl(oxido)azaniumylidene]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide |
|---|---|
| PubChem CID | 10959557 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-benzyl-1-[(4S,5S)-5-[(Z)-[benzyl(oxido)azaniumylidene]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide |
| SMILES | CC1(C)O[C@@H](/C=[N+](\[O-])Cc2ccccc2)[C@H](/C=[N+](\[O-])Cc2ccccc2)O1 |
| InChI | InChI=1S/C21H24N2O4/c1-21(2)26-19(15-22(24)13-17-9-5-3-6-10-17)20(27-21)16-23(25)14-18-11-7-4-8-12-18/h3-12,15-16,19-20H,13-14H2,1-2H3/b22-15-,23-16-/t19-,20-/m0/s1 |
| InChIKey | UPMNNLZPQNTWPD-UAHCAFNRSA-N |
| XLogP | 3.07 |
| TPSA | 70.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|