C21H26O2 — CID 15482722
(4S,5S)-2,2-dimethyl-4,5-bis(2-phenylethyl)-1,3-dioxolane (PubChem CID 15482722) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-4,5-bis(2-phenylethyl)-1,3-dioxolane.
| Compound Name | (4S,5S)-2,2-dimethyl-4,5-bis(2-phenylethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 15482722 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-4,5-bis(2-phenylethyl)-1,3-dioxolane |
| SMILES | CC1(C)O[C@@H](CCc2ccccc2)[C@H](CCc2ccccc2)O1 |
| InChI | InChI=1S/C21H26O2/c1-21(2)22-19(15-13-17-9-5-3-6-10-17)20(23-21)16-14-18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | ZVDALXNSFKNULM-PMACEKPBSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |