C45H46O2P2+2 — CID 97182330
benzyl-[[(4R,5R)-5-[[benzyl(diphenyl)phosphaniumyl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-diphenylphosphanium (PubChem CID 97182330) has the molecular formula C45H46O2P2+2 and a molecular weight of 680.81 g/mol. Its IUPAC name is benzyl-[[(4R,5R)-5-[[benzyl(diphenyl)phosphaniumyl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-diphenylphosphanium.
| Compound Name | benzyl-[[(4R,5R)-5-[[benzyl(diphenyl)phosphaniumyl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-diphenylphosphanium |
|---|---|
| PubChem CID | 97182330 |
| Molecular Formula | C45H46O2P2+2 |
| Molecular Weight | 680.81 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | benzyl-[[(4R,5R)-5-[[benzyl(diphenyl)phosphaniumyl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-diphenylphosphanium |
| SMILES | CC1(C)O[C@@H](C[P+](Cc2ccccc2)(c2ccccc2)c2ccccc2)[C@H](C[P+](Cc2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C45H46O2P2/c1-45(2)46-43(35-48(39-25-13-5-14-26-39,40-27-15-6-16-28-40)33-37-21-9-3-10-22-37)44(47-45)36-49(41-29-17-7-18-30-41,42-31-19-8-20-32-42)34-38-23-11-4-12-24-38/h3-32,43-44H,33-36H2,1-2H3/q+2/t43-,44-/m0/s1 |
| InChIKey | YHICXBALOVINFF-CXNSMIOJSA-N |
| XLogP | 9.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.81 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|