C13H18O3 — CID 123528686
(5-benzyl-2,2-dimethyl-1,3-dioxolan-4-yl)methanol (PubChem CID 123528686) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (5-benzyl-2,2-dimethyl-1,3-dioxolan-4-yl)methanol.
| Compound Name | (5-benzyl-2,2-dimethyl-1,3-dioxolan-4-yl)methanol |
|---|---|
| PubChem CID | 123528686 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (5-benzyl-2,2-dimethyl-1,3-dioxolan-4-yl)methanol |
| SMILES | CC1(C)OC(CO)C(Cc2ccccc2)O1 |
| InChI | InChI=1S/C13H18O3/c1-13(2)15-11(12(9-14)16-13)8-10-6-4-3-5-7-10/h3-7,11-12,14H,8-9H2,1-2H3 |
| InChIKey | RVBBAJFAPVANOK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |