About [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine
[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine (PubChem CID 144515048) has the molecular formula C7H17NO4S
and a molecular weight of 211.28 g/mol. Its IUPAC name is [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine |
| PubChem CID | 144515048 |
| Molecular Formula | C7H17NO4S |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine |
| SMILES | CC1(C)OC(CO)C(CO)O1.NS |
| InChI | InChI=1S/C7H14O4.H3NS/c1-7(2)10-5(3-8)6(4-9)11-7;1-2/h5-6,8-9H,3-4H2,1-2H3;2H,1H2 |
| InChIKey | QOMPBEGFHASHLK-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine?
The IUPAC name of [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine (CID 144515048) is [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine.
What is the SMILES notation for [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine?
The canonical SMILES for [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine is CC1(C)OC(CO)C(CO)O1.NS.
What is the InChIKey of [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine?
The InChIKey is QOMPBEGFHASHLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4.H3NS/c1-7(2)10-5(3-8)6(4-9)11-7;1-2/h5-6,8-9H,3-4H2,1-2H3;2H,1H2.
What are the key properties of [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine?
[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine has a molecular weight of 211.28 g/mol, XLogP of -0.72, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;thiohydroxylamine is sourced from PubChem (CID 144515048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).