C15H22O3 — CID 135083223
2-[(4R,6S)-6-benzyl-2,2-dimethyl-1,3-dioxan-4-yl]ethanol (PubChem CID 135083223) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[(4R,6S)-6-benzyl-2,2-dimethyl-1,3-dioxan-4-yl]ethanol.
| Compound Name | 2-[(4R,6S)-6-benzyl-2,2-dimethyl-1,3-dioxan-4-yl]ethanol |
|---|---|
| PubChem CID | 135083223 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-[(4R,6S)-6-benzyl-2,2-dimethyl-1,3-dioxan-4-yl]ethanol |
| SMILES | CC1(C)O[C@H](CCO)C[C@H](Cc2ccccc2)O1 |
| InChI | InChI=1S/C15H22O3/c1-15(2)17-13(8-9-16)11-14(18-15)10-12-6-4-3-5-7-12/h3-7,13-14,16H,8-11H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | IXWKSYRGCKXKBK-KGLIPLIRSA-N |
| XLogP | 2.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |