C14H19IO2 — CID 11727685
(4S,6R)-4-benzyl-6-(iodomethyl)-2,2-dimethyl-1,3-dioxane (PubChem CID 11727685) has the molecular formula C14H19IO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is (4S,6R)-4-benzyl-6-(iodomethyl)-2,2-dimethyl-1,3-dioxane.
| Compound Name | (4S,6R)-4-benzyl-6-(iodomethyl)-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 11727685 |
| Molecular Formula | C14H19IO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (4S,6R)-4-benzyl-6-(iodomethyl)-2,2-dimethyl-1,3-dioxane |
| SMILES | CC1(C)O[C@@H](CI)C[C@H](Cc2ccccc2)O1 |
| InChI | InChI=1S/C14H19IO2/c1-14(2)16-12(9-13(10-15)17-14)8-11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | OMKIPRIQCXWDMP-QWHCGFSZSA-N |
| XLogP | 3.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|