C31H32I2O2 — CID 154560381
[(4R,5R)-5-[(diphenyl-λ3-iodanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenyl-λ3-iodane (PubChem CID 154560381) has the molecular formula C31H32I2O2 and a molecular weight of 690.40 g/mol. Its IUPAC name is [(4R,5R)-5-[(diphenyl-λ3-iodanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenyl-λ3-iodane.
| Compound Name | [(4R,5R)-5-[(diphenyl-λ3-iodanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenyl-λ3-iodane |
|---|---|
| PubChem CID | 154560381 |
| Molecular Formula | C31H32I2O2 |
| Molecular Weight | 690.40 g/mol |
| Exact Mass | 690.05 |
| IUPAC Name | [(4R,5R)-5-[(diphenyl-λ3-iodanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenyl-λ3-iodane |
| SMILES | CC1(C)O[C@@H](CI(c2ccccc2)c2ccccc2)[C@H](CI(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C31H32I2O2/c1-31(2)34-29(23-32(25-15-7-3-8-16-25)26-17-9-4-10-18-26)30(35-31)24-33(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22,29-30H,23-24H2,1-2H3/t29-,30-/m0/s1 |
| InChIKey | JBCVNYGFFUXXSM-KYJUHHDHSA-N |
| XLogP | 8.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.40 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|