C13H18O3 — CID 118151829
2-[(4S,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 118151829) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-[(4S,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[(4S,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 118151829 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-[(4S,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC1(C)O[C@@H](CCO)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C13H18O3/c1-13(2)15-11(8-9-14)12(16-13)10-6-4-3-5-7-10/h3-7,11-12,14H,8-9H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | BCZDILLGOAXRAB-RYUDHWBXSA-N |
| XLogP | 2.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |