C21H30O2 — CID 15357967
(4S,5S)-2,2-dimethyl-4-[(3E,7E)-3-methylnona-3,7-dienyl]-5-phenyl-1,3-dioxolane (PubChem CID 15357967) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-4-[(3E,7E)-3-methylnona-3,7-dienyl]-5-phenyl-1,3-dioxolane.
| Compound Name | (4S,5S)-2,2-dimethyl-4-[(3E,7E)-3-methylnona-3,7-dienyl]-5-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 15357967 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-4-[(3E,7E)-3-methylnona-3,7-dienyl]-5-phenyl-1,3-dioxolane |
| SMILES | C/C=C/CC/C=C(\C)CC[C@@H]1OC(C)(C)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H30O2/c1-5-6-7-9-12-17(2)15-16-19-20(23-21(3,4)22-19)18-13-10-8-11-14-18/h5-6,8,10-14,19-20H,7,9,15-16H2,1-4H3/b6-5+,17-12+/t19-,20-/m0/s1 |
| InChIKey | KUZUVSNXLHNZNR-RMDLCUPHSA-N |
| XLogP | 5.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|