C20H31NO2 — CID 11067094
N-benzyl-1-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine (PubChem CID 11067094) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is N-benzyl-1-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine.
| Compound Name | N-benzyl-1-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine |
|---|---|
| PubChem CID | 11067094 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | N-benzyl-1-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine |
| SMILES | CCCCCCC[C@@H]1OC(C)(C)O[C@H]1/C=N/Cc1ccccc1 |
| InChI | InChI=1S/C20H31NO2/c1-4-5-6-7-11-14-18-19(23-20(2,3)22-18)16-21-15-17-12-9-8-10-13-17/h8-10,12-13,16,18-19H,4-7,11,14-15H2,1-3H3/b21-16+/t18-,19-/m0/s1 |
| InChIKey | FDYDWEZUWHIBMG-RBIDETCASA-N |
| XLogP | 5.14 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|