C31H28Cl4O2P2 — CID 118920803
[(4R,5R)-5-[bis(4-chlorophenyl)phosphanylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-bis(4-chlorophenyl)phosphane (PubChem CID 118920803) has the molecular formula C31H28Cl4O2P2 and a molecular weight of 636.32 g/mol. Its IUPAC name is [(4R,5R)-5-[bis(4-chlorophenyl)phosphanylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-bis(4-chlorophenyl)phosphane.
| Compound Name | [(4R,5R)-5-[bis(4-chlorophenyl)phosphanylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-bis(4-chlorophenyl)phosphane |
|---|---|
| PubChem CID | 118920803 |
| Molecular Formula | C31H28Cl4O2P2 |
| Molecular Weight | 636.32 g/mol |
| Exact Mass | 634.03 |
| IUPAC Name | [(4R,5R)-5-[bis(4-chlorophenyl)phosphanylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-bis(4-chlorophenyl)phosphane |
| SMILES | CC1(C)O[C@@H](CP(c2ccc(Cl)cc2)c2ccc(Cl)cc2)[C@H](CP(c2ccc(Cl)cc2)c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C31H28Cl4O2P2/c1-31(2)36-29(19-38(25-11-3-21(32)4-12-25)26-13-5-22(33)6-14-26)30(37-31)20-39(27-15-7-23(34)8-16-27)28-17-9-24(35)10-18-28/h3-18,29-30H,19-20H2,1-2H3/t29-,30-/m0/s1 |
| InChIKey | RRAQYJOXFVUROV-KYJUHHDHSA-N |
| XLogP | 8.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.32 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|