C20H31NO4Si — CID 11222658
(1R,8aS)-8a-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-oxo-1-trimethylsilyloxy-3,4,7,8-tetrahydro-2H-naphthalene-1-carbonitrile (PubChem CID 11222658) has the molecular formula C20H31NO4Si and a molecular weight of 377.56 g/mol. Its IUPAC name is (1R,8aS)-8a-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-oxo-1-trimethylsilyloxy-3,4,7,8-tetrahydro-2H-naphthalene-1-carbonitrile.
| Compound Name | (1R,8aS)-8a-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-oxo-1-trimethylsilyloxy-3,4,7,8-tetrahydro-2H-naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 11222658 |
| Molecular Formula | C20H31NO4Si |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (1R,8aS)-8a-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-oxo-1-trimethylsilyloxy-3,4,7,8-tetrahydro-2H-naphthalene-1-carbonitrile |
| SMILES | CC1(C)OC[C@H](C[C@@]23CCC(=O)C=C2CCC[C@@]3(C#N)O[Si](C)(C)C)O1 |
| InChI | InChI=1S/C20H31NO4Si/c1-18(2)23-13-17(24-18)12-19-10-8-16(22)11-15(19)7-6-9-20(19,14-21)25-26(3,4)5/h11,17H,6-10,12-13H2,1-5H3/t17-,19-,20-/m0/s1 |
| InChIKey | AEIKTFYUJYQAOQ-IHPCNDPISA-N |
| XLogP | 4.10 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|