C9H16O4S — CID 78010924
1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]cyclopropane-1-sulfinic acid (PubChem CID 78010924) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is 1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]cyclopropane-1-sulfinic acid.
| Compound Name | 1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]cyclopropane-1-sulfinic acid |
|---|---|
| PubChem CID | 78010924 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]cyclopropane-1-sulfinic acid |
| SMILES | CC1(C)OCC(CC2(S(=O)O)CC2)O1 |
| InChI | InChI=1S/C9H16O4S/c1-8(2)12-6-7(13-8)5-9(3-4-9)14(10)11/h7H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | NJUDWXWEBGTGPN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|