C23H34ClNO2Si — CID 14680111
(8R,9S,10R,13S,14S,17R)-17-[chloromethyl(dimethyl)silyl]oxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 14680111) has the molecular formula C23H34ClNO2Si and a molecular weight of 420.07 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-17-[chloromethyl(dimethyl)silyl]oxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8R,9S,10R,13S,14S,17R)-17-[chloromethyl(dimethyl)silyl]oxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 14680111 |
| Molecular Formula | C23H34ClNO2Si |
| Molecular Weight | 420.07 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-[chloromethyl(dimethyl)silyl]oxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(C#N)O[Si](C)(C)CCl |
| InChI | InChI=1S/C23H34ClNO2Si/c1-21-10-7-17(26)13-16(21)5-6-18-19(21)8-11-22(2)20(18)9-12-23(22,14-25)27-28(3,4)15-24/h13,18-20H,5-12,15H2,1-4H3/t18-,19+,20+,21+,22+,23+/m1/s1 |
| InChIKey | GVEIQFZVXIJXNW-KOORYGTMSA-N |
| XLogP | 5.78 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.07 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|