C23H26Cl4O3 — CID 18641250
[(8R,9S,10R,13S,14S,17S)-17-(2-chloroethynyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,2,2-trichloroacetate (PubChem CID 18641250) has the molecular formula C23H26Cl4O3 and a molecular weight of 492.27 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-17-(2-chloroethynyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,2,2-trichloroacetate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-17-(2-chloroethynyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 18641250 |
| Molecular Formula | C23H26Cl4O3 |
| Molecular Weight | 492.27 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-17-(2-chloroethynyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,2,2-trichloroacetate |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(C#CCl)OC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H26Cl4O3/c1-20-8-5-15(28)13-14(20)3-4-16-17(20)6-9-21(2)18(16)7-10-22(21,11-12-24)30-19(29)23(25,26)27/h13,16-18H,3-10H2,1-2H3/t16-,17+,18+,20+,21+,22-/m1/s1 |
| InChIKey | FJLZSZYFGDTWEF-WNHSNXHDSA-N |
| XLogP | 6.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.27 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|