C26H36O3 — CID 22976390
(17-ethynyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl) 2-methylbutanoate (PubChem CID 22976390) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is (17-ethynyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl) 2-methylbutanoate.
| Compound Name | (17-ethynyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 22976390 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (17-ethynyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl) 2-methylbutanoate |
| SMILES | C#CC1(OC(=O)C(C)CC)CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C26H36O3/c1-6-17(3)23(28)29-26(7-2)15-12-22-20-9-8-18-16-19(27)10-13-24(18,4)21(20)11-14-25(22,26)5/h2,16-17,20-22H,6,8-15H2,1,3-5H3 |
| InChIKey | IEMQUXXBFHLQDA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|