C22H27BrO3 — CID 88673704
[(8R,9S,10R,13S,14S,17R)-17-(2-bromoethynyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] formate (PubChem CID 88673704) has the molecular formula C22H27BrO3 and a molecular weight of 419.36 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-17-(2-bromoethynyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] formate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-17-(2-bromoethynyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] formate |
|---|---|
| PubChem CID | 88673704 |
| Molecular Formula | C22H27BrO3 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-(2-bromoethynyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] formate |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(C#CBr)OC=O |
| InChI | InChI=1S/C22H27BrO3/c1-20-8-5-16(25)13-15(20)3-4-17-18(20)6-9-21(2)19(17)7-10-22(21,11-12-23)26-14-24/h13-14,17-19H,3-10H2,1-2H3/t17-,18+,19+,20+,21+,22+/m1/s1 |
| InChIKey | KIZVNPNHOAGVRP-GUCLMQHLSA-N |
| XLogP | 4.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|