C23H33NO3Si — CID 124867519
(8R,9R,10R,13S,14R,17R)-10,13-dimethyl-3,11-dioxo-17-trimethylsilyloxy-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 124867519) has the molecular formula C23H33NO3Si and a molecular weight of 399.61 g/mol. Its IUPAC name is (8R,9R,10R,13S,14R,17R)-10,13-dimethyl-3,11-dioxo-17-trimethylsilyloxy-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8R,9R,10R,13S,14R,17R)-10,13-dimethyl-3,11-dioxo-17-trimethylsilyloxy-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 124867519 |
| Molecular Formula | C23H33NO3Si |
| Molecular Weight | 399.61 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (8R,9R,10R,13S,14R,17R)-10,13-dimethyl-3,11-dioxo-17-trimethylsilyloxy-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@H]2C(=O)C[C@@]2(C)[C@@H]1CC[C@@]2(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C23H33NO3Si/c1-21-10-8-16(25)12-15(21)6-7-17-18-9-11-23(14-24,27-28(3,4)5)22(18,2)13-19(26)20(17)21/h12,17-18,20H,6-11,13H2,1-5H3/t17-,18-,20+,21+,22+,23+/m1/s1 |
| InChIKey | IPIYLSHSOAXUMV-IPMRPHAHSA-N |
| XLogP | 4.81 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|