C23H30O6 — CID 25422375
CID 25422375 (PubChem CID 25422375) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol.
| Compound Name | CID 25422375 |
|---|---|
| PubChem CID | 25422375 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | — |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(=O)C[C@@]2(C)[C@H]1CC[C@@]21OCO[C@@]12COCO2 |
| InChI | InChI=1S/C23H30O6/c1-20-7-5-15(24)9-14(20)3-4-16-17-6-8-22(21(17,2)10-18(25)19(16)20)23(29-13-27-22)11-26-12-28-23/h9,16-17,19H,3-8,10-13H2,1-2H3/t16-,17-,19+,20-,21-,22+,23-/m0/s1 |
| InChIKey | XFMPZUDTDPMMJQ-MWJPOEIKSA-N |
| XLogP | 3.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'} |
|---|