C25H36O5 — CID 91307800
CID 91307800 (PubChem CID 91307800) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol.
| Compound Name | CID 91307800 |
|---|---|
| PubChem CID | 91307800 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | — |
| SMILES | CC.C[C@]12C=CCC=C1CC[C@@H]1[C@@H]2C(=O)C[C@@]2(C)[C@H]1CC[C@@]21OCOC12COCO2 |
| InChI | InChI=1S/C23H30O5.C2H6/c1-20-9-4-3-5-15(20)6-7-16-17-8-10-22(21(17,2)11-18(24)19(16)20)23(28-14-26-22)12-25-13-27-23;1-2/h4-5,9,16-17,19H,3,6-8,10-14H2,1-2H3;1-2H3/t16-,17-,19+,20-,21-,22+,23?;/m0./s1 |
| InChIKey | LLGISQXGSRTBBL-OKIHWRTMSA-N |
| XLogP | 4.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|