C23H32O5 — CID 1268909
CID 1268909 (PubChem CID 1268909) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol.
| Compound Name | CID 1268909 |
|---|---|
| PubChem CID | 1268909 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | — |
| SMILES | C[C@]12CC[C@@H]3[C@@H](CCC4=CC(=O)CC[C@]43C)[C@H]1CC[C@]21OCO[C@@]12COCO2 |
| InChI | InChI=1S/C23H32O5/c1-20-8-5-16(24)11-15(20)3-4-17-18(20)6-9-21(2)19(17)7-10-22(21)23(28-14-26-22)12-25-13-27-23/h11,17-19H,3-10,12-14H2,1-2H3/t17-,18-,19-,20-,21+,22+,23+/m1/s1 |
| InChIKey | WFZVFCIUAYURKP-FNGVLVINSA-N |
| XLogP | 3.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |