C24H32O7 — CID 59810282
SCHEMBL2077084 (PubChem CID 59810282) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol.
| Compound Name | SCHEMBL2077084 |
|---|---|
| PubChem CID | 59810282 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | — |
| SMILES | C[C@]12CC(C=O)C(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@@]21OCOC12COCO2 |
| InChI | InChI=1S/C24H32O7/c1-21-8-14(10-25)18(26)7-15(21)3-4-16-17-5-6-23(22(17,2)9-19(27)20(16)21)24(31-13-29-23)11-28-12-30-24/h7,10,14,16-17,19-20,27H,3-6,8-9,11-13H2,1-2H3/t14?,16-,17-,19-,20+,21-,22-,23+,24?/m0/s1 |
| InChIKey | FLZGICDDWOMLGL-JJWXCBEASA-N |
| XLogP | 2.36 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|