C32H38N2O7 — CID 59810166
CID 59810166 (PubChem CID 59810166) has the molecular formula C32H38N2O7 and a molecular weight of 562.66 g/mol.
| Compound Name | CID 59810166 |
|---|---|
| PubChem CID | 59810166 |
| Molecular Formula | C32H38N2O7 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | — |
| SMILES | COC(=O)c1cccc(-n2cc3c(n2)C=C2CC[C@@H]4[C@H]([C@@H](O)C[C@@]5(C)[C@H]4CC[C@@]54OCOC45COCO5)[C@@]2(C)C3)c1 |
| InChI | InChI=1S/C32H38N2O7/c1-29-13-20-15-34(22-6-4-5-19(11-22)28(36)37-3)33-25(20)12-21(29)7-8-23-24-9-10-31(30(24,2)14-26(35)27(23)29)32(41-18-39-31)16-38-17-40-32/h4-6,11-12,15,23-24,26-27,35H,7-10,13-14,16-18H2,1-3H3/t23-,24-,26-,27+,29-,30-,31+,32?/m0/s1 |
| InChIKey | FFXGZEIMBLAMAF-MROFLYLESA-N |
| XLogP | 4.26 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |