C30H37BrN2O5S — CID 59810184
CID 59810184 (PubChem CID 59810184) has the molecular formula C30H37BrN2O5S and a molecular weight of 617.61 g/mol.
| Compound Name | CID 59810184 |
|---|---|
| PubChem CID | 59810184 |
| Molecular Formula | C30H37BrN2O5S |
| Molecular Weight | 617.61 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | — |
| SMILES | C[C@]12Cc3cnn(Cc4ccc(CBr)s4)c3C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@@]21OCOC12COCO2 |
| InChI | InChI=1S/C30H37BrN2O5S/c1-27-10-18-13-32-33(14-21-5-4-20(12-31)39-21)24(18)9-19(27)3-6-22-23-7-8-29(28(23,2)11-25(34)26(22)27)30(38-17-36-29)15-35-16-37-30/h4-5,9,13,22-23,25-26,34H,3,6-8,10-12,14-17H2,1-2H3/t22-,23-,25-,26+,27-,28-,29+,30?/m0/s1 |
| InChIKey | HYODHOXTZLYIMW-AEKVYXDJSA-N |
| XLogP | 5.48 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|