C31H35FN4O3 — CID 161374423
1-[(17R)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-pyrazol-1-ylethanone (PubChem CID 161374423) has the molecular formula C31H35FN4O3 and a molecular weight of 530.64 g/mol. Its IUPAC name is 1-[(17R)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-pyrazol-1-ylethanone.
| Compound Name | 1-[(17R)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-pyrazol-1-ylethanone |
|---|---|
| PubChem CID | 161374423 |
| Molecular Formula | C31H35FN4O3 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 1-[(17R)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-pyrazol-1-ylethanone |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)Cn1cccn1 |
| InChI | InChI=1S/C31H35FN4O3/c1-29-15-19-17-34-36(22-7-5-21(32)6-8-22)25(19)14-20(29)4-9-23-24-10-11-31(39,27(38)18-35-13-3-12-33-35)30(24,2)16-26(37)28(23)29/h3,5-8,12-14,17,23-24,26,28,37,39H,4,9-11,15-16,18H2,1-2H3/t23?,24?,26?,28?,29?,30?,31-/m0/s1 |
| InChIKey | BQOGGUHSXQQZNL-ZLEJYYOCSA-N |
| XLogP | 4.36 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |