C26H30FN3O4 — CID 70844809
(2R,13S,17R,18S,20S)-7-(6-fluoro-3-pyridinyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxylic acid (PubChem CID 70844809) has the molecular formula C26H30FN3O4 and a molecular weight of 467.54 g/mol. Its IUPAC name is (2R,13S,17R,18S,20S)-7-(6-fluoro-3-pyridinyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxylic acid.
| Compound Name | (2R,13S,17R,18S,20S)-7-(6-fluoro-3-pyridinyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxylic acid |
|---|---|
| PubChem CID | 70844809 |
| Molecular Formula | C26H30FN3O4 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (2R,13S,17R,18S,20S)-7-(6-fluoro-3-pyridinyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxylic acid |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)nc4)c3C=C1CC[C@@H]1C2C(O)C[C@@]2(C)C1CC[C@]2(O)C(=O)O |
| InChI | InChI=1S/C26H30FN3O4/c1-24-10-14-12-29-30(16-4-6-21(27)28-13-16)19(14)9-15(24)3-5-17-18-7-8-26(34,23(32)33)25(18,2)11-20(31)22(17)24/h4,6,9,12-13,17-18,20,22,31,34H,3,5,7-8,10-11H2,1-2H3,(H,32,33)/t17-,18?,20?,22?,24-,25-,26-/m0/s1 |
| InChIKey | SWYKVHDBKNVVJX-ABIGFADMSA-N |
| XLogP | 3.38 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|