C27H32FN3O3S — CID 90832004
7-(6-fluoro-3-pyridinyl)-17-[hydroperoxy(methylsulfanyl)methylidene]-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-20-ol (PubChem CID 90832004) has the molecular formula C27H32FN3O3S and a molecular weight of 497.64 g/mol. Its IUPAC name is 7-(6-fluoro-3-pyridinyl)-17-[hydroperoxy(methylsulfanyl)methylidene]-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-20-ol.
| Compound Name | 7-(6-fluoro-3-pyridinyl)-17-[hydroperoxy(methylsulfanyl)methylidene]-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-20-ol |
|---|---|
| PubChem CID | 90832004 |
| Molecular Formula | C27H32FN3O3S |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 7-(6-fluoro-3-pyridinyl)-17-[hydroperoxy(methylsulfanyl)methylidene]-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-20-ol |
| SMILES | CSC(OO)=C1CCC2C3CCC4=Cc5c(cnn5-c5ccc(F)nc5)CC4(C)C3C(O)CC12C |
| InChI | InChI=1S/C27H32FN3O3S/c1-26-11-15-13-30-31(17-5-9-23(28)29-14-17)21(15)10-16(26)4-6-18-19-7-8-20(25(34-33)35-3)27(19,2)12-22(32)24(18)26/h5,9-10,13-14,18-19,22,24,32-33H,4,6-8,11-12H2,1-3H3 |
| InChIKey | VXQDXVJYITUABI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|