C31H35FN2O3S — CID 91804527
S-(4-hydroxybut-2-ynyl) 7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate (PubChem CID 91804527) has the molecular formula C31H35FN2O3S and a molecular weight of 534.70 g/mol. Its IUPAC name is S-(4-hydroxybut-2-ynyl) 7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate.
| Compound Name | S-(4-hydroxybut-2-ynyl) 7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate |
|---|---|
| PubChem CID | 91804527 |
| Molecular Formula | C31H35FN2O3S |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | S-(4-hydroxybut-2-ynyl) 7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1C2C(O)CC2(C)C(C(=O)SCC#CCO)CCC12 |
| InChI | InChI=1S/C31H35FN2O3S/c1-30-16-19-18-33-34(22-8-6-21(32)7-9-22)26(19)15-20(30)5-10-23-24-11-12-25(29(37)38-14-4-3-13-35)31(24,2)17-27(36)28(23)30/h6-9,15,18,23-25,27-28,35-36H,5,10-14,16-17H2,1-2H3 |
| InChIKey | HABOXJLCYPICDM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|