C35H40FN3O5S — CID 143784979
[(1S,13S,14S,20S)-17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] oxane-4-carboxylate (PubChem CID 143784979) has the molecular formula C35H40FN3O5S and a molecular weight of 633.79 g/mol. Its IUPAC name is [(1S,13S,14S,20S)-17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] oxane-4-carboxylate.
| Compound Name | [(1S,13S,14S,20S)-17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] oxane-4-carboxylate |
|---|---|
| PubChem CID | 143784979 |
| Molecular Formula | C35H40FN3O5S |
| Molecular Weight | 633.79 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | [(1S,13S,14S,20S)-17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] oxane-4-carboxylate |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CC[C@@H]1[C@@H]2[C@@H](O)CC2(C)[C@H]1CCC2(OC(=O)C1CCOCC1)C(=O)SCC#N |
| InChI | InChI=1S/C35H40FN3O5S/c1-33-18-22-20-38-39(25-6-4-24(36)5-7-25)28(22)17-23(33)3-8-26-27-9-12-35(32(42)45-16-13-37,34(27,2)19-29(40)30(26)33)44-31(41)21-10-14-43-15-11-21/h4-7,17,20-21,26-27,29-30,40H,3,8-12,14-16,18-19H2,1-2H3/t26-,27-,29-,30+,33?,34?,35?/m0/s1 |
| InChIKey | ABIQZZMCOPHEOB-YFXUNICNSA-N |
| XLogP | 5.66 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.79 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|