C34H34FN3O5S — CID 74435803
[17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] furan-2-carboxylate (PubChem CID 74435803) has the molecular formula C34H34FN3O5S and a molecular weight of 615.73 g/mol. Its IUPAC name is [17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] furan-2-carboxylate.
| Compound Name | [17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 74435803 |
| Molecular Formula | C34H34FN3O5S |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | [17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] furan-2-carboxylate |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1C2C(O)CC2(C)C1CCC2(OC(=O)c1ccco1)C(=O)SCC#N |
| InChI | InChI=1S/C34H34FN3O5S/c1-32-17-20-19-37-38(23-8-6-22(35)7-9-23)26(20)16-21(32)5-10-24-25-11-12-34(31(41)44-15-13-36,33(25,2)18-27(39)29(24)32)43-30(40)28-4-3-14-42-28/h3-4,6-9,14,16,19,24-25,27,29,39H,5,10-12,15,17-18H2,1-2H3 |
| InChIKey | DRNNFBFQIUYIKM-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|