C44H42FN3O5S — CID 91537164
[7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-[(4-pyridin-2-ylphenyl)methylsulfanylcarbonyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] furan-2-carboxylate (PubChem CID 91537164) has the molecular formula C44H42FN3O5S and a molecular weight of 743.90 g/mol. Its IUPAC name is [7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-[(4-pyridin-2-ylphenyl)methylsulfanylcarbonyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] furan-2-carboxylate.
| Compound Name | [7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-[(4-pyridin-2-ylphenyl)methylsulfanylcarbonyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 91537164 |
| Molecular Formula | C44H42FN3O5S |
| Molecular Weight | 743.90 g/mol |
| Exact Mass | 743.28 |
| IUPAC Name | [7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-[(4-pyridin-2-ylphenyl)methylsulfanylcarbonyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] furan-2-carboxylate |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1C2C(O)CC2(C)C1CCC2(OC(=O)c1ccco1)C(=O)SCc1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C44H42FN3O5S/c1-42-23-29-25-47-48(32-15-13-31(45)14-16-32)36(29)22-30(42)12-17-33-34-18-19-44(43(34,2)24-37(49)39(33)42,53-40(50)38-7-5-21-52-38)41(51)54-26-27-8-10-28(11-9-27)35-6-3-4-20-46-35/h3-11,13-16,20-22,25,33-34,37,39,49H,12,17-19,23-24,26H2,1-2H3 |
| InChIKey | TXWDUFNMSAMKPP-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.90 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|