C34H34FN3O4S2 — CID 143785027
[(1S,14S)-17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] thiophene-2-carboxylate (PubChem CID 143785027) has the molecular formula C34H34FN3O4S2 and a molecular weight of 631.80 g/mol. Its IUPAC name is [(1S,14S)-17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] thiophene-2-carboxylate.
| Compound Name | [(1S,14S)-17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 143785027 |
| Molecular Formula | C34H34FN3O4S2 |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | [(1S,14S)-17-(cyanomethylsulfanylcarbonyl)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] thiophene-2-carboxylate |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1[C@@H]2C(O)CC2(C)[C@H]1CCC2(OC(=O)c1cccs1)C(=O)SCC#N |
| InChI | InChI=1S/C34H34FN3O4S2/c1-32-17-20-19-37-38(23-8-6-22(35)7-9-23)26(20)16-21(32)5-10-24-25-11-12-34(31(41)44-15-13-36,33(25,2)18-27(39)29(24)32)42-30(40)28-4-3-14-43-28/h3-4,6-9,14,16,19,24-25,27,29,39H,5,10-12,15,17-18H2,1-2H3/t24?,25-,27?,29+,32?,33?,34?/m0/s1 |
| InChIKey | OXPGUEUZTCTIPQ-KANQMDEASA-N |
| XLogP | 6.60 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|