C32H33FN2O4S2 — CID 163560665
(13S,17R,20S)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-(thiophene-2-carbonyloxy)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid (PubChem CID 163560665) has the molecular formula C32H33FN2O4S2 and a molecular weight of 592.76 g/mol. Its IUPAC name is (13S,17R,20S)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-(thiophene-2-carbonyloxy)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid.
| Compound Name | (13S,17R,20S)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-(thiophene-2-carbonyloxy)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 163560665 |
| Molecular Formula | C32H33FN2O4S2 |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | (13S,17R,20S)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-(thiophene-2-carbonyloxy)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CC[C@@H]1C2C(O)CC2(C)C1CC[C@]2(OC(=O)c1cccs1)C(=O)S |
| InChI | InChI=1S/C32H33FN2O4S2/c1-30-15-18-17-34-35(21-8-6-20(33)7-9-21)24(18)14-19(30)5-10-22-23-11-12-32(29(38)40,31(23,2)16-25(36)27(22)30)39-28(37)26-4-3-13-41-26/h3-4,6-9,13-14,17,22-23,25,27,36H,5,10-12,15-16H2,1-2H3,(H,38,40)/t22-,23?,25?,27?,30?,31?,32-/m0/s1 |
| InChIKey | FQYBQYOMOOTLLR-ZXJGIERGSA-N |
| XLogP | 6.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|