C32H35FN2O4S — CID 89196036
(1S,2R,13S,14S,17R,18S,20S)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-(3-methylfuran-2-yl)oxy-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid (PubChem CID 89196036) has the molecular formula C32H35FN2O4S and a molecular weight of 562.71 g/mol. Its IUPAC name is (1S,2R,13S,14S,17R,18S,20S)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-(3-methylfuran-2-yl)oxy-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid.
| Compound Name | (1S,2R,13S,14S,17R,18S,20S)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-(3-methylfuran-2-yl)oxy-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 89196036 |
| Molecular Formula | C32H35FN2O4S |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (1S,2R,13S,14S,17R,18S,20S)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-17-(3-methylfuran-2-yl)oxy-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
| SMILES | Cc1ccoc1O[C@]1(C(=O)S)CC[C@H]2[C@@H]3CCC4=Cc5c(cnn5-c5ccc(F)cc5)C[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C32H35FN2O4S/c1-18-11-13-38-28(18)39-32(29(37)40)12-10-24-23-9-4-20-14-25-19(17-34-35(25)22-7-5-21(33)6-8-22)15-30(20,2)27(23)26(36)16-31(24,32)3/h5-8,11,13-14,17,23-24,26-27,36H,4,9-10,12,15-16H2,1-3H3,(H,37,40)/t23-,24-,26-,27+,30-,31-,32-/m0/s1 |
| InChIKey | BPYCMOIGFYFOCE-KKXQQNDDSA-N |
| XLogP | 6.34 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|