C28H32F2N2O3 — CID 10050883
2-(18F)fluoro-1-[(2R,17R,18S,20S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]ethanone (PubChem CID 10050883) has the molecular formula C28H32F2N2O3 and a molecular weight of 481.57 g/mol. Its IUPAC name is 2-(18F)fluoro-1-[(2R,17R,18S,20S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]ethanone.
| Compound Name | 2-(18F)fluoro-1-[(2R,17R,18S,20S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]ethanone |
|---|---|
| PubChem CID | 10050883 |
| Molecular Formula | C28H32F2N2O3 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 2-(18F)fluoro-1-[(2R,17R,18S,20S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]ethanone |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1C2C(O)C[C@@]2(C)C1CC[C@]2(O)C(=O)C[18F] |
| InChI | InChI=1S/C28H32F2N2O3/c1-26-12-16-15-31-32(19-6-4-18(30)5-7-19)22(16)11-17(26)3-8-20-21-9-10-28(35,24(34)14-29)27(21,2)13-23(33)25(20)26/h4-7,11,15,20-21,23,25,33,35H,3,8-10,12-14H2,1-2H3/t20?,21?,23?,25?,26-,27-,28-/m0/s1/i29-1 |
| InChIKey | OJKUREGQWWDLDK-BMDPFJBOSA-N |
| XLogP | 4.43 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |