C28H32F2N2O3S — CID 89196018
S-(fluoromethyl) (1S,2R,14S,17R,18S,20S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate (PubChem CID 89196018) has the molecular formula C28H32F2N2O3S and a molecular weight of 514.64 g/mol. Its IUPAC name is S-(fluoromethyl) (1S,2R,14S,17R,18S,20S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate.
| Compound Name | S-(fluoromethyl) (1S,2R,14S,17R,18S,20S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate |
|---|---|
| PubChem CID | 89196018 |
| Molecular Formula | C28H32F2N2O3S |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | S-(fluoromethyl) (1S,2R,14S,17R,18S,20S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)SCF |
| InChI | InChI=1S/C28H32F2N2O3S/c1-26-12-16-14-31-32(19-6-4-18(30)5-7-19)22(16)11-17(26)3-8-20-21-9-10-28(35,25(34)36-15-29)27(21,2)13-23(33)24(20)26/h4-7,11,14,20-21,23-24,33,35H,3,8-10,12-13,15H2,1-2H3/t20?,21-,23-,24+,26-,27-,28-/m0/s1 |
| InChIKey | KOIFTFOHJKWOIA-OZFIGLTMSA-N |
| XLogP | 5.08 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|