C35H38FN5O3 — CID 158446611
(17R)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-N-(1-methylbenzimidazol-2-yl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide (PubChem CID 158446611) has the molecular formula C35H38FN5O3 and a molecular weight of 595.72 g/mol. Its IUPAC name is (17R)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-N-(1-methylbenzimidazol-2-yl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide.
| Compound Name | (17R)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-N-(1-methylbenzimidazol-2-yl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide |
|---|---|
| PubChem CID | 158446611 |
| Molecular Formula | C35H38FN5O3 |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | (17R)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-N-(1-methylbenzimidazol-2-yl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide |
| SMILES | Cn1c(NC(=O)[C@@]2(O)CCC3C4CCC5=Cc6c(cnn6-c6ccc(F)cc6)CC5(C)C4C(O)CC32C)nc2ccccc21 |
| InChI | InChI=1S/C35H38FN5O3/c1-33-17-20-19-37-41(23-11-9-22(36)10-12-23)28(20)16-21(33)8-13-24-25-14-15-35(44,34(25,2)18-29(42)30(24)33)31(43)39-32-38-26-6-4-5-7-27(26)40(32)3/h4-7,9-12,16,19,24-25,29-30,42,44H,8,13-15,17-18H2,1-3H3,(H,38,39,43)/t24?,25?,29?,30?,33?,34?,35-/m0/s1 |
| InChIKey | MZSZYXWXJIZUIV-KSKJIKGCSA-N |
| XLogP | 5.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |