C27H30F2N2O4 — CID 67269792
(1R,2S,13R,14R,17S,18R,20R)-7-(2,4-difluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxylic acid (PubChem CID 67269792) has the molecular formula C27H30F2N2O4 and a molecular weight of 484.54 g/mol. Its IUPAC name is (1R,2S,13R,14R,17S,18R,20R)-7-(2,4-difluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxylic acid.
| Compound Name | (1R,2S,13R,14R,17S,18R,20R)-7-(2,4-difluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxylic acid |
|---|---|
| PubChem CID | 67269792 |
| Molecular Formula | C27H30F2N2O4 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (1R,2S,13R,14R,17S,18R,20R)-7-(2,4-difluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxylic acid |
| SMILES | C[C@@]12Cc3cnn(-c4ccc(F)cc4F)c3C=C1CC[C@H]1[C@H]2[C@H](O)C[C@]2(C)[C@@H]1CC[C@@]2(O)C(=O)O |
| InChI | InChI=1S/C27H30F2N2O4/c1-25-11-14-13-30-31(20-6-4-16(28)10-19(20)29)21(14)9-15(25)3-5-17-18-7-8-27(35,24(33)34)26(18,2)12-22(32)23(17)25/h4,6,9-10,13,17-18,22-23,32,35H,3,5,7-8,11-12H2,1-2H3,(H,33,34)/t17-,18-,22-,23+,25-,26-,27-/m1/s1 |
| InChIKey | YQCSLFRKAXXTMK-ASLPNSELSA-N |
| XLogP | 4.12 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |