C32H37FN2O4S — CID 163689281
(1S)-17-(cyclobutanecarbonyloxy)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid (PubChem CID 163689281) has the molecular formula C32H37FN2O4S and a molecular weight of 564.72 g/mol. Its IUPAC name is (1S)-17-(cyclobutanecarbonyloxy)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid.
| Compound Name | (1S)-17-(cyclobutanecarbonyloxy)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 163689281 |
| Molecular Formula | C32H37FN2O4S |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | (1S)-17-(cyclobutanecarbonyloxy)-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1C3CCC(OC(=O)C4CCC4)(C(=O)S)C3(C)CC(O)[C@@H]12 |
| InChI | InChI=1S/C32H37FN2O4S/c1-30-15-19-17-34-35(22-9-7-21(33)8-10-22)25(19)14-20(30)6-11-23-24-12-13-32(29(38)40,39-28(37)18-4-3-5-18)31(24,2)16-26(36)27(23)30/h7-10,14,17-18,23-24,26-27,36H,3-6,11-13,15-16H2,1-2H3,(H,38,40)/t23?,24?,26?,27-,30?,31?,32?/m1/s1 |
| InChIKey | JRNRKDBWWFWSDC-KLAAJGIJSA-N |
| XLogP | 5.70 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|