C35H45FN2O6S — CID 153256352
[(1S,14S)-7-(4-fluorophenyl)-20-hydroxy-17-[hydroxy(2-hydroxyethylsulfanyl)methyl]-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] oxane-4-carboxylate (PubChem CID 153256352) has the molecular formula C35H45FN2O6S and a molecular weight of 640.82 g/mol. Its IUPAC name is [(1S,14S)-7-(4-fluorophenyl)-20-hydroxy-17-[hydroxy(2-hydroxyethylsulfanyl)methyl]-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] oxane-4-carboxylate.
| Compound Name | [(1S,14S)-7-(4-fluorophenyl)-20-hydroxy-17-[hydroxy(2-hydroxyethylsulfanyl)methyl]-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] oxane-4-carboxylate |
|---|---|
| PubChem CID | 153256352 |
| Molecular Formula | C35H45FN2O6S |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | [(1S,14S)-7-(4-fluorophenyl)-20-hydroxy-17-[hydroxy(2-hydroxyethylsulfanyl)methyl]-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl] oxane-4-carboxylate |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1[C@@H]2C(O)CC2(C)[C@H]1CCC2(OC(=O)C1CCOCC1)C(O)SCCO |
| InChI | InChI=1S/C35H45FN2O6S/c1-33-18-22-20-37-38(25-6-4-24(36)5-7-25)28(22)17-23(33)3-8-26-27-9-12-35(32(42)45-16-13-39,34(27,2)19-29(40)30(26)33)44-31(41)21-10-14-43-15-11-21/h4-7,17,20-21,26-27,29-30,32,39-40,42H,3,8-16,18-19H2,1-2H3/t26?,27-,29?,30+,32?,33?,34?,35?/m0/s1 |
| InChIKey | WUIMLJKSKKHAKS-RUKIOADNSA-N |
| XLogP | 4.92 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|