C28H32FN3O3S2 — CID 89196040
(1S,2R,13S,14S,17R,18S,20S)-17-carbamothioyloxy-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid (PubChem CID 89196040) has the molecular formula C28H32FN3O3S2 and a molecular weight of 541.71 g/mol. Its IUPAC name is (1S,2R,13S,14S,17R,18S,20S)-17-carbamothioyloxy-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid.
| Compound Name | (1S,2R,13S,14S,17R,18S,20S)-17-carbamothioyloxy-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 89196040 |
| Molecular Formula | C28H32FN3O3S2 |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | (1S,2R,13S,14S,17R,18S,20S)-17-carbamothioyloxy-7-(4-fluorophenyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(OC(N)=S)C(=O)S |
| InChI | InChI=1S/C28H32FN3O3S2/c1-26-12-15-14-31-32(18-6-4-17(29)5-7-18)21(15)11-16(26)3-8-19-20-9-10-28(24(34)36,35-25(30)37)27(20,2)13-22(33)23(19)26/h4-7,11,14,19-20,22-23,33H,3,8-10,12-13H2,1-2H3,(H2,30,37)(H,34,36)/t19-,20-,22-,23+,26-,27-,28-/m0/s1 |
| InChIKey | QQZPASAXFBEABZ-VHGXGQECSA-N |
| XLogP | 4.62 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|