C30H35N3O4S — CID 143784713
(1S,14S)-17-(cyclopropanecarbonyloxy)-20-hydroxy-2,18-dimethyl-7-pyridin-2-yl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid (PubChem CID 143784713) has the molecular formula C30H35N3O4S and a molecular weight of 533.69 g/mol. Its IUPAC name is (1S,14S)-17-(cyclopropanecarbonyloxy)-20-hydroxy-2,18-dimethyl-7-pyridin-2-yl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid.
| Compound Name | (1S,14S)-17-(cyclopropanecarbonyloxy)-20-hydroxy-2,18-dimethyl-7-pyridin-2-yl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 143784713 |
| Molecular Formula | C30H35N3O4S |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | (1S,14S)-17-(cyclopropanecarbonyloxy)-20-hydroxy-2,18-dimethyl-7-pyridin-2-yl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
| SMILES | CC12Cc3cnn(-c4ccccn4)c3C=C1CCC1[C@@H]2C(O)CC2(C)[C@H]1CCC2(OC(=O)C1CC1)C(=O)S |
| InChI | InChI=1S/C30H35N3O4S/c1-28-14-18-16-32-33(24-5-3-4-12-31-24)22(18)13-19(28)8-9-20-21-10-11-30(27(36)38,37-26(35)17-6-7-17)29(21,2)15-23(34)25(20)28/h3-5,12-13,16-17,20-21,23,25,34H,6-11,14-15H2,1-2H3,(H,36,38)/t20?,21-,23?,25+,28?,29?,30?/m0/s1 |
| InChIKey | RCACGJQKUSPXIJ-JMALBAQASA-N |
| XLogP | 4.57 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|