C35H41N3O3S — CID 90702634
1-[20-hydroxy-7-(4-methoxyphenyl)-2,17,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-pyridin-2-ylsulfanylethanone (PubChem CID 90702634) has the molecular formula C35H41N3O3S and a molecular weight of 583.80 g/mol. Its IUPAC name is 1-[20-hydroxy-7-(4-methoxyphenyl)-2,17,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-pyridin-2-ylsulfanylethanone.
| Compound Name | 1-[20-hydroxy-7-(4-methoxyphenyl)-2,17,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-pyridin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 90702634 |
| Molecular Formula | C35H41N3O3S |
| Molecular Weight | 583.80 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 1-[20-hydroxy-7-(4-methoxyphenyl)-2,17,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-pyridin-2-ylsulfanylethanone |
| SMILES | COc1ccc(-n2ncc3c2C=C2CCC4C(C(O)CC5(C)C4CCC5(C)C(=O)CSc4ccccn4)C2(C)C3)cc1 |
| InChI | InChI=1S/C35H41N3O3S/c1-33-18-22-20-37-38(24-9-11-25(41-4)12-10-24)28(22)17-23(33)8-13-26-27-14-15-34(2,35(27,3)19-29(39)32(26)33)30(40)21-42-31-7-5-6-16-36-31/h5-7,9-12,16-17,20,26-27,29,32,39H,8,13-15,18-19,21H2,1-4H3 |
| InChIKey | XAERLSJLWAXLNB-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.80 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |