C34H39FN4O3 — CID 157329848
(2R,17R,18S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide (PubChem CID 157329848) has the molecular formula C34H39FN4O3 and a molecular weight of 570.71 g/mol. Its IUPAC name is (2R,17R,18S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide.
| Compound Name | (2R,17R,18S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide |
|---|---|
| PubChem CID | 157329848 |
| Molecular Formula | C34H39FN4O3 |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | (2R,17R,18S)-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@@]1(O)CCC2C3CCC4=Cc5c(cnn5-c5ccc(F)cc5)C[C@]4(C)C3C(O)C[C@@]21C)c1ccccn1 |
| InChI | InChI=1S/C34H39FN4O3/c1-20(27-6-4-5-15-36-27)38-31(41)34(42)14-13-26-25-12-7-22-16-28-21(19-37-39(28)24-10-8-23(35)9-11-24)17-32(22,2)30(25)29(40)18-33(26,34)3/h4-6,8-11,15-16,19-20,25-26,29-30,40,42H,7,12-14,17-18H2,1-3H3,(H,38,41)/t20-,25?,26?,29?,30?,32+,33+,34+/m1/s1 |
| InChIKey | DIKUHBQRYTUSFJ-AQBJZARVSA-N |
| XLogP | 5.17 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |