C36H39FN4O3S — CID 77403433
N-[1-(1,3-benzothiazol-2-yl)ethyl]-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide (PubChem CID 77403433) has the molecular formula C36H39FN4O3S and a molecular weight of 626.80 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)ethyl]-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide |
|---|---|
| PubChem CID | 77403433 |
| Molecular Formula | C36H39FN4O3S |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-7-(4-fluorophenyl)-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carboxamide |
| SMILES | CC(NC(=O)C1(O)CCC2C3CCC4=Cc5c(cnn5-c5ccc(F)cc5)CC4(C)C3C(O)CC21C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C36H39FN4O3S/c1-20(32-40-27-6-4-5-7-30(27)45-32)39-33(43)36(44)15-14-26-25-13-8-22-16-28-21(19-38-41(28)24-11-9-23(37)10-12-24)17-34(22,2)31(25)29(42)18-35(26,36)3/h4-7,9-12,16,19-20,25-26,29,31,42,44H,8,13-15,17-18H2,1-3H3,(H,39,43) |
| InChIKey | SPULSJMYEUVKMF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |