C38H41N3O3S — CID 75304536
1-[17,20-dihydroxy-2,18-dimethyl-7-(2-methylphenyl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-quinolin-2-ylsulfanylethanone (PubChem CID 75304536) has the molecular formula C38H41N3O3S and a molecular weight of 619.83 g/mol. Its IUPAC name is 1-[17,20-dihydroxy-2,18-dimethyl-7-(2-methylphenyl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-quinolin-2-ylsulfanylethanone.
| Compound Name | 1-[17,20-dihydroxy-2,18-dimethyl-7-(2-methylphenyl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-quinolin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 75304536 |
| Molecular Formula | C38H41N3O3S |
| Molecular Weight | 619.83 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | 1-[17,20-dihydroxy-2,18-dimethyl-7-(2-methylphenyl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-quinolin-2-ylsulfanylethanone |
| SMILES | Cc1ccccc1-n1ncc2c1C=C1CCC3C(C(O)CC4(C)C3CCC4(O)C(=O)CSc3ccc4ccccc4n3)C1(C)C2 |
| InChI | InChI=1S/C38H41N3O3S/c1-23-8-4-7-11-30(23)41-31-18-26-13-14-27-28-16-17-38(44,33(43)22-45-34-15-12-24-9-5-6-10-29(24)40-34)37(28,3)20-32(42)35(27)36(26,2)19-25(31)21-39-41/h4-12,15,18,21,27-28,32,35,42,44H,13-14,16-17,19-20,22H2,1-3H3 |
| InChIKey | HGZDEKYWWWUAJC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.83 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |