C35H43N3O4S — CID 75304688
2-(1,3-benzoxazol-2-ylsulfanyl)-1-(7-cyclohexyl-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl)ethanone (PubChem CID 75304688) has the molecular formula C35H43N3O4S and a molecular weight of 601.81 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-1-(7-cyclohexyl-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl)ethanone.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-1-(7-cyclohexyl-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl)ethanone |
|---|---|
| PubChem CID | 75304688 |
| Molecular Formula | C35H43N3O4S |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-1-(7-cyclohexyl-17,20-dihydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl)ethanone |
| SMILES | CC12Cc3cnn(C4CCCCC4)c3C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C35H43N3O4S/c1-33-17-21-19-36-38(23-8-4-3-5-9-23)27(21)16-22(33)12-13-24-25-14-15-35(41,34(25,2)18-28(39)31(24)33)30(40)20-43-32-37-26-10-6-7-11-29(26)42-32/h6-7,10-11,16,19,23-25,28,31,39,41H,3-5,8-9,12-15,17-18,20H2,1-2H3 |
| InChIKey | TUMWBNHDZBZMKU-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |