C38H40N2O4 — CID 159777550
1-[(17R)-17,20-dihydroxy-2,18-dimethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-naphthalen-2-yloxyethanone (PubChem CID 159777550) has the molecular formula C38H40N2O4 and a molecular weight of 588.75 g/mol. Its IUPAC name is 1-[(17R)-17,20-dihydroxy-2,18-dimethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-naphthalen-2-yloxyethanone.
| Compound Name | 1-[(17R)-17,20-dihydroxy-2,18-dimethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-naphthalen-2-yloxyethanone |
|---|---|
| PubChem CID | 159777550 |
| Molecular Formula | C38H40N2O4 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 1-[(17R)-17,20-dihydroxy-2,18-dimethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-naphthalen-2-yloxyethanone |
| SMILES | CC12Cc3cnn(-c4ccccc4)c3C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C38H40N2O4/c1-36-20-26-22-39-40(28-10-4-3-5-11-28)32(26)19-27(36)13-15-30-31-16-17-38(43,37(31,2)21-33(41)35(30)36)34(42)23-44-29-14-12-24-8-6-7-9-25(24)18-29/h3-12,14,18-19,22,30-31,33,35,41,43H,13,15-17,20-21,23H2,1-2H3/t30?,31?,33?,35?,36?,37?,38-/m0/s1 |
| InChIKey | SNUVOLVOQMEJNU-PWORZOIQSA-N |
| XLogP | 6.56 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |